CAS 1845698-62-5 is the registry number for Ethyl 7-bromo-2-methyl-1-propyl-1,3-benzodiazole-5-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 7-bromo-2-methyl-1-propylbenzimidazole-5-carboxylate (CAS 1845698-62-5) is a chemical compound with the molecular formula C14H17BrN2O2 and a molecular weight of 325.20 g/mol. IUPAC name: ethyl 7-bromo-2-methyl-1-propylbenzimidazole-5-carboxylate. InChIKey: QIXNDALSETXFDU-UHFFFAOYSA-N.
| Molecular formula | C14H17BrN2O2 |
|---|---|
| Molecular weight | 325.20 g/mol |
| IUPAC name | ethyl 7-bromo-2-methyl-1-propylbenzimidazole-5-carboxylate |
| InChIKey | QIXNDALSETXFDU-UHFFFAOYSA-N |
| SMILES | CCCN1C(=NC2=C1C(=CC(=C2)C(=O)OCC)Br)C |
Computed by PubChem (NCBI)