Products 444010-37-1

CAS 444010-37-1 is the registry number for 1-(Adamantan-1-yl)-4-bromo-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

1-(1-adamantyl)-4-bromopyrazole-3-carboxylic acid (CAS 444010-37-1) is a chemical compound with the molecular formula C14H17BrN2O2 and a molecular weight of 325.20 g/mol. IUPAC name: 1-(1-adamantyl)-4-bromopyrazole-3-carboxylic acid. InChIKey: DDTFERJVOWDYAP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17BrN2O2
Molecular weight325.20 g/mol
IUPAC name1-(1-adamantyl)-4-bromopyrazole-3-carboxylic acid
InChIKeyDDTFERJVOWDYAP-UHFFFAOYSA-N
SMILESC1C2CC3CC1CC(C2)(C3)N4C=C(C(=N4)C(=O)O)Br

Computed by PubChem (NCBI)