CAS 1845713-73-6 is the registry number for 8-(3,5-Dibromophenyl)-1,4-dioxa-8-azaspiro[4.5]decane, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
8-(3,5-dibromophenyl)-1,4-dioxa-8-azaspiro[4.5]decane (CAS 1845713-73-6) is a chemical compound with the molecular formula C13H15Br2NO2 and a molecular weight of 377.07 g/mol. IUPAC name: 8-(3,5-dibromophenyl)-1,4-dioxa-8-azaspiro[4.5]decane. InChIKey: MUQSVDUZCBSHTD-UHFFFAOYSA-N.
| Molecular formula | C13H15Br2NO2 |
|---|---|
| Molecular weight | 377.07 g/mol |
| IUPAC name | 8-(3,5-dibromophenyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| InChIKey | MUQSVDUZCBSHTD-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12OCCO2)C3=CC(=CC(=C3)Br)Br |
Computed by PubChem (NCBI)