CAS 2720487-05-6 is the registry number for tert-Butyl 5,6-dibromoisoindoline-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 5,6-dibromo-1,3-dihydroisoindole-2-carboxylate (CAS 2720487-05-6) is a chemical compound with the molecular formula C13H15Br2NO2 and a molecular weight of 377.07 g/mol. IUPAC name: tert-butyl 5,6-dibromo-1,3-dihydroisoindole-2-carboxylate. InChIKey: LFRNOGFRCBPTLE-UHFFFAOYSA-N.
| Molecular formula | C13H15Br2NO2 |
|---|---|
| Molecular weight | 377.07 g/mol |
| IUPAC name | tert-butyl 5,6-dibromo-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | LFRNOGFRCBPTLE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC(=C(C=C2C1)Br)Br |
Computed by PubChem (NCBI)