Products 184576-87-2
CAS 184576-87-2 appears in our catalog under these names: ROS 234 dioxalate, ROS 234. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
N-[3-(1H-imidazol-5-yl)propyl]-1H-benzimidazol-2-amine;oxalic acid (CAS 184576-87-2) is a chemical compound with the molecular formula C17H19N5O8 and a molecular weight of 421.4 g/mol. IUPAC name: N-[3-(1H-imidazol-5-yl)propyl]-1H-benzimidazol-2-amine;oxalic acid. InChIKey: JKTBCMILCFDKEJ-UHFFFAOYSA-N.
| Molecular formula | C17H19N5O8 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | N-[3-(1H-imidazol-5-yl)propyl]-1H-benzimidazol-2-amine;oxalic acid |
| InChIKey | JKTBCMILCFDKEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)NCCCC3=CN=CN3.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)