Products 184708-66-5
CAS 184708-66-5 appears in our catalog under these names: Palmitoleic Acid–d14, Palmitoleic acid-d14, 99.6%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 100μg, 500μg, 100 μg (3.72 mM * 100 μL in Ethanol).
(Z)-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecadeuteriohexadec-9-enoic acid (CAS 184708-66-5) is a chemical compound with the molecular formula C16H30O2 and a molecular weight of 268.49 g/mol. IUPAC name: (Z)-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecadeuteriohexadec-9-enoic acid. InChIKey: SECPZKHBENQXJG-VXXNRCPDSA-N.
| Molecular formula | C16H30O2 |
|---|---|
| Molecular weight | 268.49 g/mol |
| IUPAC name | (Z)-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecadeuteriohexadec-9-enoic acid |
| InChIKey | SECPZKHBENQXJG-VXXNRCPDSA-N |
| SMILES | [2H]C([2H])(/C=C\CCCCCC)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)