Products 2692623-91-7
CAS 2692623-91-7 appears in our catalog under these names: Palmitelaidic Acid–d13, Palmitelaidic acid-d13, 99.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 500μg, 1 mg (37.38 mM * 100 μL in Ethanol).
(E)-11,11,12,12,13,13,14,14,15,15,16,16,16-tridecadeuteriohexadec-9-enoic acid (CAS 2692623-91-7) is a chemical compound with the molecular formula C16H30O2 and a molecular weight of 267.49 g/mol. IUPAC name: (E)-11,11,12,12,13,13,14,14,15,15,16,16,16-tridecadeuteriohexadec-9-enoic acid. InChIKey: SECPZKHBENQXJG-BWLIMJNUSA-N.
| Molecular formula | C16H30O2 |
|---|---|
| Molecular weight | 267.49 g/mol |
| IUPAC name | (E)-11,11,12,12,13,13,14,14,15,15,16,16,16-tridecadeuteriohexadec-9-enoic acid |
| InChIKey | SECPZKHBENQXJG-BWLIMJNUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])/C=C/CCCCCCCC(=O)O |
Computed by PubChem (NCBI)