CAS 184719-80-0 appears in our catalog under these names: (R)–tert–Butyl pyrrolidine–2–carboxylate hydrochloride, H-D-Pro-OtBu·HCl 98%, (R)-tert-Butyl pyrrolidine-2-carboxylate hydrochloride, 98%, 98%, h-d-pro-ptbu.hcl, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 100mg, 250mg, 1g, 100g.
Tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride (CAS 184719-80-0) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride. InChIKey: IUUYANMOEMBTBV-OGFXRTJISA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | tert-butyl (2R)-pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | IUUYANMOEMBTBV-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)[C@H]1CCCN1.Cl |
Computed by PubChem (NCBI)