CAS 18472-89-4 is the registry number for Cresyl Violet. Offered by: TRC. Available pack sizes: 250mg.
(5-amino-10-methylbenzo[a]phenoxazin-9-ylidene)-dimethylazanium chloride (CAS 18472-89-4) is a chemical compound with the molecular formula C19H18ClN3O and a molecular weight of 339.8 g/mol. IUPAC name: (5-amino-10-methylbenzo[a]phenoxazin-9-ylidene)-dimethylazanium chloride. InChIKey: ZHAFUINZIZIXFC-UHFFFAOYSA-N.
| Molecular formula | C19H18ClN3O |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | (5-amino-10-methylbenzo[a]phenoxazin-9-ylidene)-dimethylazanium chloride |
| InChIKey | ZHAFUINZIZIXFC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC3=C(C=C(C4=CC=CC=C43)N)OC2=CC1=[N+](C)C.[Cl-] |
Computed by PubChem (NCBI)