Products 2839158-50-6
CAS 2839158-50-6 is the registry number for Heme Oxygenase-1-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(4-chlorophenyl)-phenylmethyl]-2-imidazol-1-yl-N-methylacetamide (CAS 2839158-50-6) is a chemical compound with the molecular formula C19H18ClN3O and a molecular weight of 339.8 g/mol. IUPAC name: N-[(4-chlorophenyl)-phenylmethyl]-2-imidazol-1-yl-N-methylacetamide. InChIKey: ABNHYFNEPLHVLN-UHFFFAOYSA-N.
| Molecular formula | C19H18ClN3O |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | N-[(4-chlorophenyl)-phenylmethyl]-2-imidazol-1-yl-N-methylacetamide |
| InChIKey | ABNHYFNEPLHVLN-UHFFFAOYSA-N |
| SMILES | CN(C(C1=CC=CC=C1)C2=CC=C(C=C2)Cl)C(=O)CN3C=CN=C3 |
Computed by PubChem (NCBI)
Synonyms:
Heme Oxygenase-1-IN-2