CAS 184840-63-9 is the registry number for Fmoc-D-Leu-OPfp, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate (CAS 184840-63-9) is a chemical compound with the molecular formula C27H22F5NO4 and a molecular weight of 519.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate. InChIKey: NTQJCLLWLHKJLU-LJQANCHMSA-N.
| Molecular formula | C27H22F5NO4 |
|---|---|
| Molecular weight | 519.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoate |
| InChIKey | NTQJCLLWLHKJLU-LJQANCHMSA-N |
| SMILES | CC(C)C[C@H](C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)