CAS 86060-89-1 appears in our catalog under these names: Fmoc–Ile–OPfp, Fmoc-Ile-OPfp 95+%, Fmoc-Ile-OPfp, 95+%, 95+%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g.
(2,3,4,5,6-pentafluorophenyl) (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate (CAS 86060-89-1) is a chemical compound with the molecular formula C27H22F5NO4 and a molecular weight of 519.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate. InChIKey: FYZSBHSHLNJGPS-RZFZLAGVSA-N.
| Molecular formula | C27H22F5NO4 |
|---|---|
| Molecular weight | 519.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoate |
| InChIKey | FYZSBHSHLNJGPS-RZFZLAGVSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)