Products 184848-82-6

CAS 184848-82-6 is the registry number for N-Nitro-N'-((tetrahydro-3-furanyl)methyl)carbamimidothioic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.

Structural formula: {0} (CAS {1})

Methyl N-nitro-N'-(oxolan-3-ylmethyl)carbamimidothioate (CAS 184848-82-6) is a chemical compound with the molecular formula C7H13N3O3S and a molecular weight of 219.26 g/mol. IUPAC name: methyl N-nitro-N'-(oxolan-3-ylmethyl)carbamimidothioate. InChIKey: YEIMMWYLPXMTAY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13N3O3S
Molecular weight219.26 g/mol
IUPAC namemethyl N-nitro-N'-(oxolan-3-ylmethyl)carbamimidothioate
InChIKeyYEIMMWYLPXMTAY-UHFFFAOYSA-N
SMILESCSC(=NCC1CCOC1)N[N+](=O)[O-]

Computed by PubChem (NCBI)