Products 2955551-40-1
CAS 2955551-40-1 is the registry number for 4-ethoxy-N,N-dimethyl-pyrazole-1-sulfonamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide (CAS 2955551-40-1) is a chemical compound with the molecular formula C7H13N3O3S and a molecular weight of 219.26 g/mol. IUPAC name: 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide. InChIKey: PLHUXEIFOLLSFC-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O3S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 4-ethoxy-N,N-dimethylpyrazole-1-sulfonamide |
| InChIKey | PLHUXEIFOLLSFC-UHFFFAOYSA-N |
| SMILES | CCOC1=CN(N=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)