CAS 1849-36-1 appears in our catalog under these names: 4-Nitrothiophenol (Contains Dimer), 4–Nitrothiophenol, 4-Nitrothiophenol, 96% , 4-Nitrobenzenethiol, >95.0%(GC)(T), 4-Nitrothiophenol 95%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g.
4-nitrobenzenethiol (CAS 1849-36-1) is a chemical compound with the molecular formula C6H5NO2S and a molecular weight of 155.18 g/mol. IUPAC name: 4-nitrobenzenethiol. InChIKey: AXBVSRMHOPMXBA-UHFFFAOYSA-N.
| Molecular formula | C6H5NO2S |
|---|---|
| Molecular weight | 155.18 g/mol |
| IUPAC name | 4-nitrobenzenethiol |
| InChIKey | AXBVSRMHOPMXBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S |
Computed by PubChem (NCBI)