CAS 3814-18-4 appears in our catalog under these names: 3-Nitrobenzene-1-thiol, 95%, Benzenethiol, 3-nitro-, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 100mg.
3-nitrobenzenethiol (CAS 3814-18-4) is a chemical compound with the molecular formula C6H5NO2S and a molecular weight of 155.18 g/mol. IUPAC name: 3-nitrobenzenethiol. InChIKey: HBCSOCHVMJKLLO-UHFFFAOYSA-N.
| Molecular formula | C6H5NO2S |
|---|---|
| Molecular weight | 155.18 g/mol |
| IUPAC name | 3-nitrobenzenethiol |
| InChIKey | HBCSOCHVMJKLLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S)[N+](=O)[O-] |
Computed by PubChem (NCBI)