CAS 184906-29-4 appears in our catalog under these names: 5-Methoxy-3,3-dimethylisoindolin-1-one, 97%, 5–Methoxy–3，3–dimethylisoindolin–1–one, 5-Methoxy-3,3-dimethylisoindolin-1-one. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
5-methoxy-3,3-dimethyl-2H-isoindol-1-one (CAS 184906-29-4) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 5-methoxy-3,3-dimethyl-2H-isoindol-1-one. InChIKey: ZLMBGBZUFNKJRJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 5-methoxy-3,3-dimethyl-2H-isoindol-1-one |
| InChIKey | ZLMBGBZUFNKJRJ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)OC)C(=O)N1)C |
Computed by PubChem (NCBI)