Products 1849624-95-8
CAS 1849624-95-8 is the registry number for (2-Amino-5-chlorophenyl)(3-fluoropyridin-2-yl)methanone, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
(2-amino-5-chlorophenyl)-(3-fluoro-2-pyridinyl)methanone (CAS 1849624-95-8) is a chemical compound with the molecular formula C12H8ClFN2O and a molecular weight of 250.65 g/mol. IUPAC name: (2-amino-5-chlorophenyl)-(3-fluoro-2-pyridinyl)methanone. InChIKey: AVOKCSINMMKZMC-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFN2O |
|---|---|
| Molecular weight | 250.65 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)-(3-fluoro-2-pyridinyl)methanone |
| InChIKey | AVOKCSINMMKZMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C(=O)C2=C(C=CC(=C2)Cl)N)F |
Computed by PubChem (NCBI)