CAS 325457-98-5 appears in our catalog under these names: ZTZ240/ 99.93% (existing batch purity), N-(6-chloropyridin-3-yl)-4-fluorobenzamide, ztz240. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 1mg, 5mg, 10mg, 5 mg, 1 mg.
N-(6-chloro-3-pyridinyl)-4-fluorobenzamide (CAS 325457-98-5) is a chemical compound with the molecular formula C12H8ClFN2O and a molecular weight of 250.65 g/mol. IUPAC name: N-(6-chloro-3-pyridinyl)-4-fluorobenzamide. InChIKey: URPKVELJRWKNQS-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFN2O |
|---|---|
| Molecular weight | 250.65 g/mol |
| IUPAC name | N-(6-chloro-3-pyridinyl)-4-fluorobenzamide |
| InChIKey | URPKVELJRWKNQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CN=C(C=C2)Cl)F |
Computed by PubChem (NCBI)