CAS 1850376-93-0 appears in our catalog under these names: 4-Bromo-2-chlorophenyl propionate, 95%, 4-Bromo-2-chlorophenyl propionate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 25g, 5g.
(4-bromo-2-chlorophenyl) propanoate (CAS 1850376-93-0) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: (4-bromo-2-chlorophenyl) propanoate. InChIKey: RLCIZFLAAOIPQL-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | (4-bromo-2-chlorophenyl) propanoate |
| InChIKey | RLCIZFLAAOIPQL-UHFFFAOYSA-N |
| SMILES | CCC(=O)OC1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)