CAS 185077-02-5 is the registry number for 3–Fluoro–4–methylphenylmagnesium bromide. Offered by: GLPBio. Available pack sizes: 100ml.
Magnesium;1-fluoro-2-methylbenzene-5-ide;bromide (CAS 185077-02-5) is a chemical compound with the molecular formula C7H6BrFMg and a molecular weight of 213.33 g/mol. IUPAC name: magnesium;1-fluoro-2-methylbenzene-5-ide;bromide. InChIKey: QLGSDGDHUROFKU-UHFFFAOYSA-M.
| Molecular formula | C7H6BrFMg |
|---|---|
| Molecular weight | 213.33 g/mol |
| IUPAC name | magnesium;1-fluoro-2-methylbenzene-5-ide;bromide |
| InChIKey | QLGSDGDHUROFKU-UHFFFAOYSA-M |
| SMILES | CC1=C(C=[C-]C=C1)F.[Mg+2].[Br-] |
Computed by PubChem (NCBI)