CAS 186496-59-3 appears in our catalog under these names: 5–Fluoro–2–methylphenylmagnesium bromide, 5-Fluoro-2-methylphenylmagnesium bromide, 0.5M solution in THF, AcroSeal®. Offered by: GLPBio, Thermo Scientific (Acros). Available pack sizes: 100ml, 50ML.
Magnesium;1-fluoro-4-methylbenzene-5-ide;bromide (CAS 186496-59-3) is a chemical compound with the molecular formula C7H6BrFMg and a molecular weight of 213.33 g/mol. IUPAC name: magnesium;1-fluoro-4-methylbenzene-5-ide;bromide. InChIKey: QMSOVQIRHRUQIX-UHFFFAOYSA-M.
| Molecular formula | C7H6BrFMg |
|---|---|
| Molecular weight | 213.33 g/mol |
| IUPAC name | magnesium;1-fluoro-4-methylbenzene-5-ide;bromide |
| InChIKey | QMSOVQIRHRUQIX-UHFFFAOYSA-M |
| SMILES | CC1=[C-]C=C(C=C1)F.[Mg+2].[Br-] |
Computed by PubChem (NCBI)