CAS 18511-69-8 appears in our catalog under these names: 4,4'-Diamino-2,2'-bipyridine, >95% (HPLC), (NH2)2bpy, 4,4'-Diamino-2,2'-bipyridine, 4,4'-Diamino-2,2'-bipyridyl, >98.0%(GC)(T), [2,2'-Bipyridine]-4,4'-diamine, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 2,5g, 500mg, 5g, 2g, 200mg, 10g, 100mg.
2-(4-amino-2-pyridinyl)pyridin-4-amine (CAS 18511-69-8) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 2-(4-amino-2-pyridinyl)pyridin-4-amine. InChIKey: WTHJTVKLMSJXEV-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-(4-amino-2-pyridinyl)pyridin-4-amine |
| InChIKey | WTHJTVKLMSJXEV-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1N)C2=NC=CC(=C2)N |
Computed by PubChem (NCBI)