CAS 879558-15-3 is the registry number for 1-Isopropyl-1,2,3-benzotriazole-5-carbonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g.
1-propan-2-ylbenzotriazole-5-carbonitrile (CAS 879558-15-3) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 1-propan-2-ylbenzotriazole-5-carbonitrile. InChIKey: HDWQPSYFWYMOAQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 1-propan-2-ylbenzotriazole-5-carbonitrile |
| InChIKey | HDWQPSYFWYMOAQ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C=C(C=C2)C#N)N=N1 |
Computed by PubChem (NCBI)