Products 1851317-37-7

CAS 1851317-37-7 appears in our catalog under these names: 4-Methylfuran-3-sulfonyl chloride, 95%, 4-Methylfuran-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

4-methylfuran-3-sulfonyl chloride (CAS 1851317-37-7) is a chemical compound with the molecular formula C5H5ClO3S and a molecular weight of 180.61 g/mol. IUPAC name: 4-methylfuran-3-sulfonyl chloride. InChIKey: NYTLCOJJHVPVMB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5ClO3S
Molecular weight180.61 g/mol
IUPAC name4-methylfuran-3-sulfonyl chloride
InChIKeyNYTLCOJJHVPVMB-UHFFFAOYSA-N
SMILESCC1=COC=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)