Products 69815-95-8

CAS 69815-95-8 appears in our catalog under these names: 5-METHYLFURAN-2-SULFONYL CHLORIDE, 95%, 95%, 5–Methylfuran–2–sulfonyl chloride, 5-Methylfuran-2-sulfonyl chloride, 97%. Offered by: Chemat, GLPBio, Fluorochem. Available pack sizes: 100mg, 25mg.

Structural formula: {0} (CAS {1})

5-methylfuran-2-sulfonyl chloride (CAS 69815-95-8) is a chemical compound with the molecular formula C5H5ClO3S and a molecular weight of 180.61 g/mol. IUPAC name: 5-methylfuran-2-sulfonyl chloride. InChIKey: YNNRJWKCQVUBDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5ClO3S
Molecular weight180.61 g/mol
IUPAC name5-methylfuran-2-sulfonyl chloride
InChIKeyYNNRJWKCQVUBDZ-UHFFFAOYSA-N
SMILESCC1=CC=C(O1)S(=O)(=O)Cl

Computed by PubChem (NCBI)