Products 1851789-45-1
CAS 1851789-45-1 is the registry number for 3-Bromo-2-fluoro-n-isobutyl-n-methyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-2-fluoro-N-methyl-N-(2-methylpropyl)benzamide (CAS 1851789-45-1) is a chemical compound with the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. IUPAC name: 3-bromo-2-fluoro-N-methyl-N-(2-methylpropyl)benzamide. InChIKey: WPDXRJIKAFXWNB-UHFFFAOYSA-N.
| Molecular formula | C12H15BrFNO |
|---|---|
| Molecular weight | 288.16 g/mol |
| IUPAC name | 3-bromo-2-fluoro-N-methyl-N-(2-methylpropyl)benzamide |
| InChIKey | WPDXRJIKAFXWNB-UHFFFAOYSA-N |
| SMILES | CC(C)CN(C)C(=O)C1=C(C(=CC=C1)Br)F |
Computed by PubChem (NCBI)