CAS 2030483-55-5 is the registry number for 2-(4-Bromo-2-fluoro-phenyl)-n,n-diethyl-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-bromo-2-fluorophenyl)-N,N-diethylacetamide (CAS 2030483-55-5) is a chemical compound with the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-N,N-diethylacetamide. InChIKey: ATJSDVYAGOBCOT-UHFFFAOYSA-N.
| Molecular formula | C12H15BrFNO |
|---|---|
| Molecular weight | 288.16 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)-N,N-diethylacetamide |
| InChIKey | ATJSDVYAGOBCOT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)CC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)