CAS 1851916-79-4 is the registry number for 3-Bromo-N-(2,2-dimethylthietan-3-yl)-5-methylpyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-N-(2,2-dimethylthietan-3-yl)-5-methylpyridin-2-amine (CAS 1851916-79-4) is a chemical compound with the molecular formula C11H15BrN2S and a molecular weight of 287.22 g/mol. IUPAC name: 3-bromo-N-(2,2-dimethylthietan-3-yl)-5-methylpyridin-2-amine. InChIKey: NFHCHLCQYRZWHS-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2S |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | 3-bromo-N-(2,2-dimethylthietan-3-yl)-5-methylpyridin-2-amine |
| InChIKey | NFHCHLCQYRZWHS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)NC2CSC2(C)C)Br |
Computed by PubChem (NCBI)