Products 1864052-59-4
CAS 1864052-59-4 is the registry number for 6-Butyl-1,3-benzothiazol-2-amine hydrobromide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
6-butyl-1,3-benzothiazol-2-amine;hydrobromide (CAS 1864052-59-4) is a chemical compound with the molecular formula C11H15BrN2S and a molecular weight of 287.22 g/mol. IUPAC name: 6-butyl-1,3-benzothiazol-2-amine;hydrobromide. InChIKey: LLORBZQONQDYHN-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2S |
|---|---|
| Molecular weight | 287.22 g/mol |
| IUPAC name | 6-butyl-1,3-benzothiazol-2-amine;hydrobromide |
| InChIKey | LLORBZQONQDYHN-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC2=C(C=C1)N=C(S2)N.Br |
Computed by PubChem (NCBI)