Products 185256-49-9
CAS 185256-49-9 appears in our catalog under these names: tert-Butyl ((1s,2r)-2-phenylcyclopropyl)carbamate, 95%, trans–tert–buthyl–2–phenylcyclopropyl carbamate, trans-tert-buthyl-2-phenylcyclopropyl carbamate. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(1S,2R)-2-phenylcyclopropyl]carbamate (CAS 185256-49-9) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-phenylcyclopropyl]carbamate. InChIKey: MBZAGPLGLMIZOL-NEPJUHHUSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-phenylcyclopropyl]carbamate |
| InChIKey | MBZAGPLGLMIZOL-NEPJUHHUSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H]1C2=CC=CC=C2 |
Computed by PubChem (NCBI)