CAS 1852643-88-9 is the registry number for 3-((5-Aminopyrimidin-4-yl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-N-(1,1-dioxothietan-3-yl)pyrimidine-4,5-diamine (CAS 1852643-88-9) is a chemical compound with the molecular formula C7H10N4O2S and a molecular weight of 214.25 g/mol. IUPAC name: 4-N-(1,1-dioxothietan-3-yl)pyrimidine-4,5-diamine. InChIKey: FRGLHCZKPUVNNB-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O2S |
|---|---|
| Molecular weight | 214.25 g/mol |
| IUPAC name | 4-N-(1,1-dioxothietan-3-yl)pyrimidine-4,5-diamine |
| InChIKey | FRGLHCZKPUVNNB-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)NC2=NC=NC=C2N |
Computed by PubChem (NCBI)