CAS 46298-53-7 is the registry number for 5-Nitro-2-(piperazin-1-yl)thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitro-2-piperazin-1-yl-1,3-thiazole (CAS 46298-53-7) is a chemical compound with the molecular formula C7H10N4O2S and a molecular weight of 214.25 g/mol. IUPAC name: 5-nitro-2-piperazin-1-yl-1,3-thiazole. InChIKey: YHGMKWIHCNMCHP-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O2S |
|---|---|
| Molecular weight | 214.25 g/mol |
| IUPAC name | 5-nitro-2-piperazin-1-yl-1,3-thiazole |
| InChIKey | YHGMKWIHCNMCHP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=C(S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)