CAS 1852848-11-3 is the registry number for 2-(Dimethylamino)-1-(3,4,5-trifluorophenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(dimethylamino)-1-(3,4,5-trifluorophenyl)ethanol (CAS 1852848-11-3) is a chemical compound with the molecular formula C10H12F3NO and a molecular weight of 219.20 g/mol. IUPAC name: 2-(dimethylamino)-1-(3,4,5-trifluorophenyl)ethanol. InChIKey: QEMPOWXQAVOYFY-UHFFFAOYSA-N.
| Molecular formula | C10H12F3NO |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 2-(dimethylamino)-1-(3,4,5-trifluorophenyl)ethanol |
| InChIKey | QEMPOWXQAVOYFY-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CC(=C(C(=C1)F)F)F)O |
Computed by PubChem (NCBI)