CAS 1853132-06-5 is the registry number for 5-Methyl-2-(propan-2-yl)cyclohexyl 2-(3-benzoylphenyl)propanoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(5-methyl-2-propan-2-ylcyclohexyl) 2-(3-benzoylphenyl)propanoate (CAS 1853132-06-5) is a chemical compound with the molecular formula C26H32O3 and a molecular weight of 392.5 g/mol. IUPAC name: (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-benzoylphenyl)propanoate. InChIKey: XYUNBQODAOFFBO-UHFFFAOYSA-N.
| Molecular formula | C26H32O3 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(3-benzoylphenyl)propanoate |
| InChIKey | XYUNBQODAOFFBO-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C1)OC(=O)C(C)C2=CC(=CC=C2)C(=O)C3=CC=CC=C3)C(C)C |
Computed by PubChem (NCBI)