CAS 2098704-06-2 is the registry number for Ketoprofen Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-(3-benzoylphenyl)propanoate (CAS 2098704-06-2) is a chemical compound with the molecular formula C26H32O3 and a molecular weight of 392.5 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-(3-benzoylphenyl)propanoate. InChIKey: XYUNBQODAOFFBO-PBIIQAGSSA-N.
| Molecular formula | C26H32O3 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-(3-benzoylphenyl)propanoate |
| InChIKey | XYUNBQODAOFFBO-PBIIQAGSSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)[C@H](C)C2=CC(=CC=C2)C(=O)C3=CC=CC=C3)C(C)C |
Computed by PubChem (NCBI)