Products 1854816-90-2
CAS 1854816-90-2 is the registry number for 2-(Azetidin-3-yl)-N-(1,1-dioxidothietan-3-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(azetidin-3-yl)-N-(1,1-dioxothietan-3-yl)acetamide (CAS 1854816-90-2) is a chemical compound with the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. IUPAC name: 2-(azetidin-3-yl)-N-(1,1-dioxothietan-3-yl)acetamide. InChIKey: BQUIAPMKNZQXGB-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O3S |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | 2-(azetidin-3-yl)-N-(1,1-dioxothietan-3-yl)acetamide |
| InChIKey | BQUIAPMKNZQXGB-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CC(=O)NC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)