CAS 1862061-36-6 is the registry number for 1-Amino-N-(1,1-dioxidothietan-3-yl)cyclobutanecarboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-amino-N-(1,1-dioxothietan-3-yl)cyclobutane-1-carboxamide (CAS 1862061-36-6) is a chemical compound with the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. IUPAC name: 1-amino-N-(1,1-dioxothietan-3-yl)cyclobutane-1-carboxamide. InChIKey: AGXMEVBKELEQOC-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O3S |
|---|---|
| Molecular weight | 218.28 g/mol |
| IUPAC name | 1-amino-N-(1,1-dioxothietan-3-yl)cyclobutane-1-carboxamide |
| InChIKey | AGXMEVBKELEQOC-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(=O)NC2CS(=O)(=O)C2)N |
Computed by PubChem (NCBI)