CAS 185547-52-8 appears in our catalog under these names: (3S)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-[(4-nitrophenyl)carbamoyl]propanoic acid, 95%, Fmoc-Asp-pNA, 95+%, Fmoc-L-Asp-pNA. Offered by: Combi-blocks, AmBeed, Iris Biotech. Available pack sizes: 1g, 10g, 5g, 250mg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-nitroanilino)-4-oxobutanoic acid (CAS 185547-52-8) is a chemical compound with the molecular formula C25H21N3O7 and a molecular weight of 475.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-nitroanilino)-4-oxobutanoic acid. InChIKey: WIGASSLCYMGNEA-QFIPXVFZSA-N.
| Molecular formula | C25H21N3O7 |
|---|---|
| Molecular weight | 475.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-nitroanilino)-4-oxobutanoic acid |
| InChIKey | WIGASSLCYMGNEA-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)O)C(=O)NC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)