CAS 71989-17-8 appears in our catalog under these names: Fmoc-asn-onp, 95%, (S)-4-Nitrophenyl 2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-amino-4-oxobutanoate, 97%, Fmoc–Asn–ONp. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 1g, 25g.
(4-nitrophenyl) (2S)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate (CAS 71989-17-8) is a chemical compound with the molecular formula C25H21N3O7 and a molecular weight of 475.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate. InChIKey: MPNFRQBESOZRJG-QFIPXVFZSA-N.
| Molecular formula | C25H21N3O7 |
|---|---|
| Molecular weight | 475.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoate |
| InChIKey | MPNFRQBESOZRJG-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)N)C(=O)OC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)