Products 185555-66-2
CAS 185555-66-2 appears in our catalog under these names: 2–amino–4–(2–hydroxyphenyl)butanoic acid, 2-Amino-4-(2-hydroxyphenyl)butanoic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-amino-4-(2-hydroxyphenyl)butanoic acid (CAS 185555-66-2) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-amino-4-(2-hydroxyphenyl)butanoic acid. InChIKey: ORMODNFPWYQQHE-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-amino-4-(2-hydroxyphenyl)butanoic acid |
| InChIKey | ORMODNFPWYQQHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC(C(=O)O)N)O |
Computed by PubChem (NCBI)
Synonyms:
Benzenebutanoic acid, a-amino-2-hydroxy-