Products 1855889-86-9
CAS 1855889-86-9 is the registry number for methyl 1,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 1,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate (CAS 1855889-86-9) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: methyl 1,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate. InChIKey: QUYWMNUHNJLPHC-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | methyl 1,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylate |
| InChIKey | QUYWMNUHNJLPHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=NN(C2=N1)C)C(=O)OC |
Computed by PubChem (NCBI)