CAS 1856076-30-6 is the registry number for Methyl 1-(2,2-difluoroethyl)-4-nitro-1H-pyrazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(2,2-difluoroethyl)-4-nitropyrazole-3-carboxylate (CAS 1856076-30-6) is a chemical compound with the molecular formula C7H7F2N3O4 and a molecular weight of 235.14 g/mol. IUPAC name: methyl 1-(2,2-difluoroethyl)-4-nitropyrazole-3-carboxylate. InChIKey: DVSWPUBMKUKBMV-UHFFFAOYSA-N.
| Molecular formula | C7H7F2N3O4 |
|---|---|
| Molecular weight | 235.14 g/mol |
| IUPAC name | methyl 1-(2,2-difluoroethyl)-4-nitropyrazole-3-carboxylate |
| InChIKey | DVSWPUBMKUKBMV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C=C1[N+](=O)[O-])CC(F)F |
Computed by PubChem (NCBI)