CAS 925607-46-1 appears in our catalog under these names: [3-(Difluoromethyl)-5-methyl-4-nitro-1h-pyrazol-1-yl]acetic acid, 95%, 2-(3-(Difluoromethyl)-5-methyl-4-nitro-1H-pyrazol-1-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetic acid (CAS 925607-46-1) is a chemical compound with the molecular formula C7H7F2N3O4 and a molecular weight of 235.14 g/mol. IUPAC name: 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetic acid. InChIKey: DDUHAPRAGZZKCT-UHFFFAOYSA-N.
| Molecular formula | C7H7F2N3O4 |
|---|---|
| Molecular weight | 235.14 g/mol |
| IUPAC name | 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetic acid |
| InChIKey | DDUHAPRAGZZKCT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(=O)O)C(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)