CAS 185622-62-2 is the registry number for (3aR,4R,6aS)-3a,6a-Dihydro-2,2-diemthyl-4H-cyclopenta-1,3-dioxol-4-ol. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
(3aR,4R,6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (CAS 185622-62-2) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: (3aR,4R,6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-ol. InChIKey: FXOFSGSXPYHEMV-DSYKOEDSSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (3aR,4R,6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| InChIKey | FXOFSGSXPYHEMV-DSYKOEDSSA-N |
| SMILES | CC1(O[C@H]2C=C[C@H]([C@H]2O1)O)C |
Computed by PubChem (NCBI)