CAS 683276-44-0 is the registry number for (3AS,6aR)-2,2-dimethyl-3a,6a-dihydro-4H-cyclopenta[d][1,3]dioxol-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aS,6aR)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (CAS 683276-44-0) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: (3aS,6aR)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-ol. InChIKey: FXOFSGSXPYHEMV-FWPZAIACSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (3aS,6aR)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| InChIKey | FXOFSGSXPYHEMV-FWPZAIACSA-N |
| SMILES | CC1(O[C@@H]2C=CC([C@@H]2O1)O)C |
Computed by PubChem (NCBI)