CAS 185672-33-7 appears in our catalog under these names: 2,3,4,6,7-Pentamethyl-2-(4,8,12-trimethyltridecyl)-2,3-dihydrobenzofuran-5-ol, 98+%, Tocopherol Impurity 61, All-rac-alfa-Tocopherol EP Impurity A (Mixture of Diastereomers), Tocopherol Impurity 13（Mixture of All-rac-α-Tocopherol EP Impurity A and B）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,3,4,6,7-pentamethyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-ol (CAS 185672-33-7) is a chemical compound with the molecular formula C29H50O2 and a molecular weight of 430.7 g/mol. IUPAC name: 2,3,4,6,7-pentamethyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-ol. InChIKey: PMIMOLIQGNWOJE-UHFFFAOYSA-N.
| Molecular formula | C29H50O2 |
|---|---|
| Molecular weight | 430.7 g/mol |
| IUPAC name | 2,3,4,6,7-pentamethyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-ol |
| InChIKey | PMIMOLIQGNWOJE-UHFFFAOYSA-N |
| SMILES | CC1C2=C(C(=C(C(=C2C)O)C)C)OC1(C)CCCC(C)CCCC(C)CCCC(C)C |
Computed by PubChem (NCBI)