CAS 77171-98-3 is the registry number for (2R, 4’S, 8’S)-alpha-Tocopherol. Offered by: TRC. Available pack sizes: 25mg.
(2R)-2,5,7,8-tetramethyl-2-[(4S,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol (CAS 77171-98-3) is a chemical compound with the molecular formula C29H50O2 and a molecular weight of 430.7 g/mol. IUPAC name: (2R)-2,5,7,8-tetramethyl-2-[(4S,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol. InChIKey: GVJHHUAWPYXKBD-IHMCZWCLSA-N.
| Molecular formula | C29H50O2 |
|---|---|
| Molecular weight | 430.7 g/mol |
| IUPAC name | (2R)-2,5,7,8-tetramethyl-2-[(4S,8S)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
| InChIKey | GVJHHUAWPYXKBD-IHMCZWCLSA-N |
| SMILES | CC1=C(C2=C(CC[C@@](O2)(C)CCC[C@@H](C)CCC[C@@H](C)CCCC(C)C)C(=C1O)C)C |
Computed by PubChem (NCBI)