Products 1857793-86-2
CAS 1857793-86-2 is the registry number for 3-((4-Methylthiophen-3-yl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothietan-3-yl)-4-methylthiophen-3-amine (CAS 1857793-86-2) is a chemical compound with the molecular formula C8H11NO2S2 and a molecular weight of 217.3 g/mol. IUPAC name: N-(1,1-dioxothietan-3-yl)-4-methylthiophen-3-amine. InChIKey: PXQNVBXJKCTELB-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S2 |
|---|---|
| Molecular weight | 217.3 g/mol |
| IUPAC name | N-(1,1-dioxothietan-3-yl)-4-methylthiophen-3-amine |
| InChIKey | PXQNVBXJKCTELB-UHFFFAOYSA-N |
| SMILES | CC1=CSC=C1NC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)