CAS 252010-04-1 appears in our catalog under these names: Ethyl 3,4-dimethyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carboxylate, 95%, Ethyl 3,4-dimethyl-2-thioxo-2,3-dihydrothiazole-5-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Ethyl 3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carboxylate (CAS 252010-04-1) is a chemical compound with the molecular formula C8H11NO2S2 and a molecular weight of 217.3 g/mol. IUPAC name: ethyl 3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carboxylate. InChIKey: CWOLSMXDNJBTGT-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S2 |
|---|---|
| Molecular weight | 217.3 g/mol |
| IUPAC name | ethyl 3,4-dimethyl-2-sulfanylidene-1,3-thiazole-5-carboxylate |
| InChIKey | CWOLSMXDNJBTGT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=S)S1)C)C |
Computed by PubChem (NCBI)